C8H13NO3S — CID 127006196
7-methylsulfinyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 127006196) has the molecular formula C8H13NO3S and a molecular weight of 203.26 g/mol. Its IUPAC name is 7-methylsulfinyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | 7-methylsulfinyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 127006196 |
| Molecular Formula | C8H13NO3S |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 7-methylsulfinyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | CS(=O)N1C2CCC1C(C(=O)O)C2 |
| InChI | InChI=1S/C8H13NO3S/c1-13(12)9-5-2-3-7(9)6(4-5)8(10)11/h5-7H,2-4H2,1H3,(H,10,11) |
| InChIKey | CAFXVVWFLIKUPG-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |