About 7-(3-methyl-1,1-dioxo-1,4-thiazinane-4-carbonyl)-7-azabicyclo[2.2.1]heptane-2-carboxylic acid
7-(3-methyl-1,1-dioxo-1,4-thiazinane-4-carbonyl)-7-azabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 102885025) has the molecular formula C13H20N2O5S
and a molecular weight of 316.38 g/mol. Its IUPAC name is 7-(3-methyl-1,1-dioxo-1,4-thiazinane-4-carbonyl)-7-azabicyclo[2.2.1]heptane-2-carboxylic acid.
Molecular Properties
| Compound Name | 7-(3-methyl-1,1-dioxo-1,4-thiazinane-4-carbonyl)-7-azabicyclo[2.2.1]heptane-2-carboxylic acid |
| PubChem CID | 102885025 |
| Molecular Formula | C13H20N2O5S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 7-(3-methyl-1,1-dioxo-1,4-thiazinane-4-carbonyl)-7-azabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | CC1CS(=O)(=O)CCN1C(=O)N1C2CCC1C(C(=O)O)C2 |
| InChI | InChI=1S/C13H20N2O5S/c1-8-7-21(19,20)5-4-14(8)13(18)15-9-2-3-11(15)10(6-9)12(16)17/h8-11H,2-7H2,1H3,(H,16,17) |
| InChIKey | FXAKYIGFHNJGCY-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(3-methyl-1,1-dioxo-1,4-thiazinane-4-carbonyl)-7-azabicyclo[2.2.1]heptane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3-methyl-1,1-dioxo-1,4-thiazinane-4-carbonyl)-7-azabicyclo[2.2.1]heptane-2-carboxylic acid?
The IUPAC name of 7-(3-methyl-1,1-dioxo-1,4-thiazinane-4-carbonyl)-7-azabicyclo[2.2.1]heptane-2-carboxylic acid (CID 102885025) is 7-(3-methyl-1,1-dioxo-1,4-thiazinane-4-carbonyl)-7-azabicyclo[2.2.1]heptane-2-carboxylic acid.
What is the SMILES notation for 7-(3-methyl-1,1-dioxo-1,4-thiazinane-4-carbonyl)-7-azabicyclo[2.2.1]heptane-2-carboxylic acid?
The canonical SMILES for 7-(3-methyl-1,1-dioxo-1,4-thiazinane-4-carbonyl)-7-azabicyclo[2.2.1]heptane-2-carboxylic acid is CC1CS(=O)(=O)CCN1C(=O)N1C2CCC1C(C(=O)O)C2.
What is the InChIKey of 7-(3-methyl-1,1-dioxo-1,4-thiazinane-4-carbonyl)-7-azabicyclo[2.2.1]heptane-2-carboxylic acid?
The InChIKey is FXAKYIGFHNJGCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O5S/c1-8-7-21(19,20)5-4-14(8)13(18)15-9-2-3-11(15)10(6-9)12(16)17/h8-11H,2-7H2,1H3,(H,16,17).
What are the key properties of 7-(3-methyl-1,1-dioxo-1,4-thiazinane-4-carbonyl)-7-azabicyclo[2.2.1]heptane-2-carboxylic acid?
7-(3-methyl-1,1-dioxo-1,4-thiazinane-4-carbonyl)-7-azabicyclo[2.2.1]heptane-2-carboxylic acid has a molecular weight of 316.38 g/mol, XLogP of 0.16, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3-methyl-1,1-dioxo-1,4-thiazinane-4-carbonyl)-7-azabicyclo[2.2.1]heptane-2-carboxylic acid is sourced from PubChem (CID 102885025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).