About imidazol-1-yl-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone
imidazol-1-yl-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone (PubChem CID 103840643) has the molecular formula C9H13N3O3S
and a molecular weight of 243.29 g/mol. Its IUPAC name is imidazol-1-yl-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone.
Molecular Properties
| Compound Name | imidazol-1-yl-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone |
| PubChem CID | 103840643 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | imidazol-1-yl-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone |
| SMILES | CC1CS(=O)(=O)CCN1C(=O)n1ccnc1 |
| InChI | InChI=1S/C9H13N3O3S/c1-8-6-16(14,15)5-4-12(8)9(13)11-3-2-10-7-11/h2-3,7-8H,4-6H2,1H3 |
| InChIKey | QVCZESSOCALLJO-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze imidazol-1-yl-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazol-1-yl-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone?
The IUPAC name of imidazol-1-yl-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone (CID 103840643) is imidazol-1-yl-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone.
What is the SMILES notation for imidazol-1-yl-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone?
The canonical SMILES for imidazol-1-yl-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone is CC1CS(=O)(=O)CCN1C(=O)n1ccnc1.
What is the InChIKey of imidazol-1-yl-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone?
The InChIKey is QVCZESSOCALLJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O3S/c1-8-6-16(14,15)5-4-12(8)9(13)11-3-2-10-7-11/h2-3,7-8H,4-6H2,1H3.
What are the key properties of imidazol-1-yl-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone?
imidazol-1-yl-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone has a molecular weight of 243.29 g/mol, XLogP of -0.03, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for imidazol-1-yl-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone is sourced from PubChem (CID 103840643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).