C8H13ClN4O — CID 127006864
4-[1-aminopropan-2-yl(methyl)amino]-5-chloro-1H-pyridazin-6-one (PubChem CID 127006864) has the molecular formula C8H13ClN4O and a molecular weight of 216.67 g/mol. Its IUPAC name is 4-[1-aminopropan-2-yl(methyl)amino]-5-chloro-1H-pyridazin-6-one.
| Compound Name | 4-[1-aminopropan-2-yl(methyl)amino]-5-chloro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 127006864 |
| Molecular Formula | C8H13ClN4O |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 4-[1-aminopropan-2-yl(methyl)amino]-5-chloro-1H-pyridazin-6-one |
| SMILES | CC(CN)N(C)c1cn[nH]c(=O)c1Cl |
| InChI | InChI=1S/C8H13ClN4O/c1-5(3-10)13(2)6-4-11-12-8(14)7(6)9/h4-5H,3,10H2,1-2H3,(H,12,14) |
| InChIKey | JRLGHQOGPRZQAU-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |