C7H13FO — CID 12700789
trans-(1R,2R)-1-fluoro-2-methoxycyclohexane (PubChem CID 12700789) has the molecular formula C7H13FO and a molecular weight of 132.18 g/mol. Its IUPAC name is trans-(1R,2R)-1-fluoro-2-methoxycyclohexane.
| Compound Name | trans-(1R,2R)-1-fluoro-2-methoxycyclohexane |
|---|---|
| PubChem CID | 12700789 |
| Molecular Formula | C7H13FO |
| Molecular Weight | 132.18 g/mol |
| Exact Mass | 132.10 |
| IUPAC Name | trans-(1R,2R)-1-fluoro-2-methoxycyclohexane |
| SMILES | CO[C@@H]1CCCC[C@H]1F |
| InChI | InChI=1S/C7H13FO/c1-9-7-5-3-2-4-6(7)8/h6-7H,2-5H2,1H3/t6-,7-/m1/s1 |
| InChIKey | ZVARKDFRCWVEBF-RNFRBKRXSA-N |
| XLogP | 1.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.18 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |