C7H13ClN2O3S — CID 127011592
1-chloro-N-(2-methyl-6-oxopiperidin-3-yl)methanesulfonamide (PubChem CID 127011592) has the molecular formula C7H13ClN2O3S and a molecular weight of 240.71 g/mol. Its IUPAC name is 1-chloro-N-(2-methyl-6-oxopiperidin-3-yl)methanesulfonamide.
| Compound Name | 1-chloro-N-(2-methyl-6-oxopiperidin-3-yl)methanesulfonamide |
|---|---|
| PubChem CID | 127011592 |
| Molecular Formula | C7H13ClN2O3S |
| Molecular Weight | 240.71 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 1-chloro-N-(2-methyl-6-oxopiperidin-3-yl)methanesulfonamide |
| SMILES | CC1NC(=O)CCC1NS(=O)(=O)CCl |
| InChI | InChI=1S/C7H13ClN2O3S/c1-5-6(2-3-7(11)9-5)10-14(12,13)4-8/h5-6,10H,2-4H2,1H3,(H,9,11) |
| InChIKey | UELBDKGJZZQJLH-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.71 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|