C6H12ClNO4S2 — CID 130710681
1-chloro-N-(2-methyl-1,1-dioxothiolan-3-yl)methanesulfonamide (PubChem CID 130710681) has the molecular formula C6H12ClNO4S2 and a molecular weight of 261.75 g/mol. Its IUPAC name is 1-chloro-N-(2-methyl-1,1-dioxothiolan-3-yl)methanesulfonamide.
| Compound Name | 1-chloro-N-(2-methyl-1,1-dioxothiolan-3-yl)methanesulfonamide |
|---|---|
| PubChem CID | 130710681 |
| Molecular Formula | C6H12ClNO4S2 |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 260.99 |
| IUPAC Name | 1-chloro-N-(2-methyl-1,1-dioxothiolan-3-yl)methanesulfonamide |
| SMILES | CC1C(NS(=O)(=O)CCl)CCS1(=O)=O |
| InChI | InChI=1S/C6H12ClNO4S2/c1-5-6(2-3-13(5,9)10)8-14(11,12)4-7/h5-6,8H,2-4H2,1H3 |
| InChIKey | RVNNQZOVXMRIDC-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|