C7H14N2O2S2 — CID 130969391
1-methyl-3-[(2S,3S)-2-methyl-1,1-dioxothiolan-3-yl]thiourea (PubChem CID 130969391) has the molecular formula C7H14N2O2S2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-methyl-3-[(2S,3S)-2-methyl-1,1-dioxothiolan-3-yl]thiourea.
| Compound Name | 1-methyl-3-[(2S,3S)-2-methyl-1,1-dioxothiolan-3-yl]thiourea |
|---|---|
| PubChem CID | 130969391 |
| Molecular Formula | C7H14N2O2S2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 1-methyl-3-[(2S,3S)-2-methyl-1,1-dioxothiolan-3-yl]thiourea |
| SMILES | CNC(=S)N[C@H]1CCS(=O)(=O)[C@H]1C |
| InChI | InChI=1S/C7H14N2O2S2/c1-5-6(9-7(12)8-2)3-4-13(5,10)11/h5-6H,3-4H2,1-2H3,(H2,8,9,12)/t5-,6-/m0/s1 |
| InChIKey | FKXBUONLFMIJCI-WDSKDSINSA-N |
| XLogP | -0.34 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|