C7H14N2O2S — CID 130676291
1-[(3S,4R)-4-methoxyoxolan-3-yl]-3-methylthiourea (PubChem CID 130676291) has the molecular formula C7H14N2O2S and a molecular weight of 190.27 g/mol. Its IUPAC name is 1-[(3S,4R)-4-methoxyoxolan-3-yl]-3-methylthiourea.
| Compound Name | 1-[(3S,4R)-4-methoxyoxolan-3-yl]-3-methylthiourea |
|---|---|
| PubChem CID | 130676291 |
| Molecular Formula | C7H14N2O2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 1-[(3S,4R)-4-methoxyoxolan-3-yl]-3-methylthiourea |
| SMILES | CNC(=S)N[C@H]1COC[C@@H]1OC |
| InChI | InChI=1S/C7H14N2O2S/c1-8-7(12)9-5-3-11-4-6(5)10-2/h5-6H,3-4H2,1-2H3,(H2,8,9,12)/t5-,6-/m0/s1 |
| InChIKey | WGSCCLDBOHDKNO-WDSKDSINSA-N |
| XLogP | -0.51 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|