C10H19NO3 — CID 131181570
N-[(3S,4R)-4-methoxyoxolan-3-yl]oxan-3-amine (PubChem CID 131181570) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is N-[(3S,4R)-4-methoxyoxolan-3-yl]oxan-3-amine.
| Compound Name | N-[(3S,4R)-4-methoxyoxolan-3-yl]oxan-3-amine |
|---|---|
| PubChem CID | 131181570 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | N-[(3S,4R)-4-methoxyoxolan-3-yl]oxan-3-amine |
| SMILES | CO[C@H]1COC[C@@H]1NC1CCCOC1 |
| InChI | InChI=1S/C10H19NO3/c1-12-10-7-14-6-9(10)11-8-3-2-4-13-5-8/h8-11H,2-7H2,1H3/t8?,9-,10-/m0/s1 |
| InChIKey | QMRFIBMSCBLZJW-AGROOBSYSA-N |
| XLogP | 0.17 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |