C7H16ClNO2 — CID 178190292
(3R,4R)-4-methoxy-N-methyloxan-3-amine;hydrochloride (PubChem CID 178190292) has the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. Its IUPAC name is (3R,4R)-4-methoxy-N-methyloxan-3-amine;hydrochloride.
| Compound Name | (3R,4R)-4-methoxy-N-methyloxan-3-amine;hydrochloride |
|---|---|
| PubChem CID | 178190292 |
| Molecular Formula | C7H16ClNO2 |
| Molecular Weight | 181.66 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | (3R,4R)-4-methoxy-N-methyloxan-3-amine;hydrochloride |
| SMILES | CN[C@@H]1COCC[C@H]1OC.Cl |
| InChI | InChI=1S/C7H15NO2.ClH/c1-8-6-5-10-4-3-7(6)9-2;/h6-8H,3-5H2,1-2H3;1H/t6-,7-;/m1./s1 |
| InChIKey | VSVHQJBJDCSLOS-ZJLYAJKPSA-N |
| XLogP | 0.43 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.66 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |