About 4-chloro-3-methoxyoxane
4-chloro-3-methoxyoxane (PubChem CID 130632423) has the molecular formula C6H11ClO2
and a molecular weight of 150.60 g/mol. Its IUPAC name is 4-chloro-3-methoxyoxane.
Molecular Properties
| Compound Name | 4-chloro-3-methoxyoxane |
| PubChem CID | 130632423 |
| Molecular Formula | C6H11ClO2 |
| Molecular Weight | 150.60 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | 4-chloro-3-methoxyoxane |
| SMILES | COC1COCCC1Cl |
| InChI | InChI=1S/C6H11ClO2/c1-8-6-4-9-3-2-5(6)7/h5-6H,2-4H2,1H3 |
| InChIKey | SESMLCBRBCYGCU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.60 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3-methoxyoxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-methoxyoxane?
The IUPAC name of 4-chloro-3-methoxyoxane (CID 130632423) is 4-chloro-3-methoxyoxane.
What is the SMILES notation for 4-chloro-3-methoxyoxane?
The canonical SMILES for 4-chloro-3-methoxyoxane is COC1COCCC1Cl.
What is the InChIKey of 4-chloro-3-methoxyoxane?
The InChIKey is SESMLCBRBCYGCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11ClO2/c1-8-6-4-9-3-2-5(6)7/h5-6H,2-4H2,1H3.
What are the key properties of 4-chloro-3-methoxyoxane?
4-chloro-3-methoxyoxane has a molecular weight of 150.60 g/mol, XLogP of 1.03, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-methoxyoxane is sourced from PubChem (CID 130632423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).