C13H23NO2S — CID 141394628
N-[(3aR,5S,6aR)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]thiophen-5-yl]-3-methoxyoxan-4-amine (PubChem CID 141394628) has the molecular formula C13H23NO2S and a molecular weight of 257.40 g/mol. Its IUPAC name is N-[(3aR,5S,6aR)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]thiophen-5-yl]-3-methoxyoxan-4-amine.
| Compound Name | N-[(3aR,5S,6aR)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]thiophen-5-yl]-3-methoxyoxan-4-amine |
|---|---|
| PubChem CID | 141394628 |
| Molecular Formula | C13H23NO2S |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | N-[(3aR,5S,6aR)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]thiophen-5-yl]-3-methoxyoxan-4-amine |
| SMILES | COC1COCCC1N[C@H]1C[C@@H]2CCS[C@@H]2C1 |
| InChI | InChI=1S/C13H23NO2S/c1-15-12-8-16-4-2-11(12)14-10-6-9-3-5-17-13(9)7-10/h9-14H,2-8H2,1H3/t9-,10-,11?,12?,13+/m0/s1 |
| InChIKey | DRFKFJURASKMMF-YJEBHAJESA-N |
| XLogP | 1.66 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |