C24H41NO4 — CID 142943067
benzyl 3-[(3-methoxyoxan-4-yl)amino]cyclopentane-1-carboxylate;ethane;propane (PubChem CID 142943067) has the molecular formula C24H41NO4 and a molecular weight of 407.60 g/mol. Its IUPAC name is benzyl 3-[(3-methoxyoxan-4-yl)amino]cyclopentane-1-carboxylate;ethane;propane.
| Compound Name | benzyl 3-[(3-methoxyoxan-4-yl)amino]cyclopentane-1-carboxylate;ethane;propane |
|---|---|
| PubChem CID | 142943067 |
| Molecular Formula | C24H41NO4 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.30 |
| IUPAC Name | benzyl 3-[(3-methoxyoxan-4-yl)amino]cyclopentane-1-carboxylate;ethane;propane |
| SMILES | CC.CCC.COC1COCCC1NC1CCC(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C19H27NO4.C3H8.C2H6/c1-22-18-13-23-10-9-17(18)20-16-8-7-15(11-16)19(21)24-12-14-5-3-2-4-6-14;1-3-2;1-2/h2-6,15-18,20H,7-13H2,1H3;3H2,1-2H3;1-2H3 |
| InChIKey | ZMHMPJQXMYAJGY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |