C20H27NO6 — CID 146344524
benzyl 4-[(3-hydroxy-1-methoxy-1-oxobutan-2-yl)carbamoyl]cyclohexane-1-carboxylate (PubChem CID 146344524) has the molecular formula C20H27NO6 and a molecular weight of 377.44 g/mol. Its IUPAC name is benzyl 4-[(3-hydroxy-1-methoxy-1-oxobutan-2-yl)carbamoyl]cyclohexane-1-carboxylate.
| Compound Name | benzyl 4-[(3-hydroxy-1-methoxy-1-oxobutan-2-yl)carbamoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 146344524 |
| Molecular Formula | C20H27NO6 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | benzyl 4-[(3-hydroxy-1-methoxy-1-oxobutan-2-yl)carbamoyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C(NC(=O)C1CCC(C(=O)OCc2ccccc2)CC1)C(C)O |
| InChI | InChI=1S/C20H27NO6/c1-13(22)17(20(25)26-2)21-18(23)15-8-10-16(11-9-15)19(24)27-12-14-6-4-3-5-7-14/h3-7,13,15-17,22H,8-12H2,1-2H3,(H,21,23) |
| InChIKey | RXLUGBOPKOQHTR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |