C12H15N3O2S — CID 91793439
N-[(3S,4R)-3-methoxyoxan-4-yl]thieno[3,2-d]pyrimidin-4-amine (PubChem CID 91793439) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is N-[(3S,4R)-3-methoxyoxan-4-yl]thieno[3,2-d]pyrimidin-4-amine.
| Compound Name | N-[(3S,4R)-3-methoxyoxan-4-yl]thieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 91793439 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | N-[(3S,4R)-3-methoxyoxan-4-yl]thieno[3,2-d]pyrimidin-4-amine |
| SMILES | CO[C@@H]1COCC[C@H]1Nc1ncnc2ccsc12 |
| InChI | InChI=1S/C12H15N3O2S/c1-16-10-6-17-4-2-8(10)15-12-11-9(3-5-18-11)13-7-14-12/h3,5,7-8,10H,2,4,6H2,1H3,(H,13,14,15)/t8-,10-/m1/s1 |
| InChIKey | UMJDWEHJJOODCB-PSASIEDQSA-N |
| XLogP | 1.91 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |