C12H16N4S — CID 61037130
2-N-thieno[3,2-d]pyrimidin-4-ylcyclohexane-1,2-diamine (PubChem CID 61037130) has the molecular formula C12H16N4S and a molecular weight of 248.35 g/mol. Its IUPAC name is 2-N-thieno[3,2-d]pyrimidin-4-ylcyclohexane-1,2-diamine.
| Compound Name | 2-N-thieno[3,2-d]pyrimidin-4-ylcyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 61037130 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 2-N-thieno[3,2-d]pyrimidin-4-ylcyclohexane-1,2-diamine |
| SMILES | NC1CCCCC1Nc1ncnc2ccsc12 |
| InChI | InChI=1S/C12H16N4S/c13-8-3-1-2-4-9(8)16-12-11-10(5-6-17-11)14-7-15-12/h5-9H,1-4,13H2,(H,14,15,16) |
| InChIKey | PJPZIRFZRXNJLB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |