About 2-N-thieno[3,2-d]pyrimidin-4-ylcyclohexane-1,2-diamine
2-N-thieno[3,2-d]pyrimidin-4-ylcyclohexane-1,2-diamine (PubChem CID 61037130) has the molecular formula C12H16N4S
and a molecular weight of 248.35 g/mol. Its IUPAC name is 2-N-thieno[3,2-d]pyrimidin-4-ylcyclohexane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-thieno[3,2-d]pyrimidin-4-ylcyclohexane-1,2-diamine |
| PubChem CID | 61037130 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 2-N-thieno[3,2-d]pyrimidin-4-ylcyclohexane-1,2-diamine |
| SMILES | NC1CCCCC1Nc1ncnc2ccsc12 |
| InChI | InChI=1S/C12H16N4S/c13-8-3-1-2-4-9(8)16-12-11-10(5-6-17-11)14-7-15-12/h5-9H,1-4,13H2,(H,14,15,16) |
| InChIKey | PJPZIRFZRXNJLB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-N-thieno[3,2-d]pyrimidin-4-ylcyclohexane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-thieno[3,2-d]pyrimidin-4-ylcyclohexane-1,2-diamine?
The IUPAC name of 2-N-thieno[3,2-d]pyrimidin-4-ylcyclohexane-1,2-diamine (CID 61037130) is 2-N-thieno[3,2-d]pyrimidin-4-ylcyclohexane-1,2-diamine.
What is the SMILES notation for 2-N-thieno[3,2-d]pyrimidin-4-ylcyclohexane-1,2-diamine?
The canonical SMILES for 2-N-thieno[3,2-d]pyrimidin-4-ylcyclohexane-1,2-diamine is NC1CCCCC1Nc1ncnc2ccsc12.
What is the InChIKey of 2-N-thieno[3,2-d]pyrimidin-4-ylcyclohexane-1,2-diamine?
The InChIKey is PJPZIRFZRXNJLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4S/c13-8-3-1-2-4-9(8)16-12-11-10(5-6-17-11)14-7-15-12/h5-9H,1-4,13H2,(H,14,15,16).
What are the key properties of 2-N-thieno[3,2-d]pyrimidin-4-ylcyclohexane-1,2-diamine?
2-N-thieno[3,2-d]pyrimidin-4-ylcyclohexane-1,2-diamine has a molecular weight of 248.35 g/mol, XLogP of 2.37, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-thieno[3,2-d]pyrimidin-4-ylcyclohexane-1,2-diamine is sourced from PubChem (CID 61037130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).