C8H17NO2S — CID 167913931
(2R,3R)-2-methyl-1,1-dioxo-N-propan-2-ylthiolan-3-amine (PubChem CID 167913931) has the molecular formula C8H17NO2S and a molecular weight of 191.30 g/mol. Its IUPAC name is (2R,3R)-2-methyl-1,1-dioxo-N-propan-2-ylthiolan-3-amine.
| Compound Name | (2R,3R)-2-methyl-1,1-dioxo-N-propan-2-ylthiolan-3-amine |
|---|---|
| PubChem CID | 167913931 |
| Molecular Formula | C8H17NO2S |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.10 |
| IUPAC Name | (2R,3R)-2-methyl-1,1-dioxo-N-propan-2-ylthiolan-3-amine |
| SMILES | CC(C)N[C@@H]1CCS(=O)(=O)[C@@H]1C |
| InChI | InChI=1S/C8H17NO2S/c1-6(2)9-8-4-5-12(10,11)7(8)3/h6-9H,4-5H2,1-3H3/t7-,8-/m1/s1 |
| InChIKey | ZIGPNBPMROZNLE-HTQZYQBOSA-N |
| XLogP | 0.56 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |