C6H12O3S — CID 54103725
(2R,3R)-3-methoxy-2-methylthiolane 1,1-dioxide (PubChem CID 54103725) has the molecular formula C6H12O3S and a molecular weight of 164.23 g/mol. Its IUPAC name is (2R,3R)-3-methoxy-2-methylthiolane 1,1-dioxide.
| Compound Name | (2R,3R)-3-methoxy-2-methylthiolane 1,1-dioxide |
|---|---|
| PubChem CID | 54103725 |
| Molecular Formula | C6H12O3S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | (2R,3R)-3-methoxy-2-methylthiolane 1,1-dioxide |
| SMILES | CO[C@@H]1CCS(=O)(=O)[C@@H]1C |
| InChI | InChI=1S/C6H12O3S/c1-5-6(9-2)3-4-10(5,7)8/h5-6H,3-4H2,1-2H3/t5-,6-/m1/s1 |
| InChIKey | NCHGYHGLJILZEI-PHDIDXHHSA-N |
| XLogP | 0.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |