C10H17N3O2 — CID 127020438
3,3-dimethyl-2-[(1-methylpyrazol-4-yl)amino]butanoic acid (PubChem CID 127020438) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 3,3-dimethyl-2-[(1-methylpyrazol-4-yl)amino]butanoic acid.
| Compound Name | 3,3-dimethyl-2-[(1-methylpyrazol-4-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 127020438 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 3,3-dimethyl-2-[(1-methylpyrazol-4-yl)amino]butanoic acid |
| SMILES | Cn1cc(NC(C(=O)O)C(C)(C)C)cn1 |
| InChI | InChI=1S/C10H17N3O2/c1-10(2,3)8(9(14)15)12-7-5-11-13(4)6-7/h5-6,8,12H,1-4H3,(H,14,15) |
| InChIKey | NYSZDRCBAUVXIO-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |