C12H17N3O4 — CID 67744655
2-[3-methyl-3-[(1-methylpyrazol-4-yl)amino]butan-2-ylidene]propanedioic acid (PubChem CID 67744655) has the molecular formula C12H17N3O4 and a molecular weight of 267.29 g/mol. Its IUPAC name is 2-[3-methyl-3-[(1-methylpyrazol-4-yl)amino]butan-2-ylidene]propanedioic acid.
| Compound Name | 2-[3-methyl-3-[(1-methylpyrazol-4-yl)amino]butan-2-ylidene]propanedioic acid |
|---|---|
| PubChem CID | 67744655 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 2-[3-methyl-3-[(1-methylpyrazol-4-yl)amino]butan-2-ylidene]propanedioic acid |
| SMILES | CC(=C(C(=O)O)C(=O)O)C(C)(C)Nc1cnn(C)c1 |
| InChI | InChI=1S/C12H17N3O4/c1-7(9(10(16)17)11(18)19)12(2,3)14-8-5-13-15(4)6-8/h5-6,14H,1-4H3,(H,16,17)(H,18,19) |
| InChIKey | CQWCDANMDNPXEL-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|