C23H29F6N3O7 — CID 127021991
2-[(3aR,7S,7aS)-2-(pyridin-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-1-morpholin-4-ylethanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127021991) has the molecular formula C23H29F6N3O7 and a molecular weight of 573.49 g/mol. Its IUPAC name is 2-[(3aR,7S,7aS)-2-(pyridin-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-1-morpholin-4-ylethanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[(3aR,7S,7aS)-2-(pyridin-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-1-morpholin-4-ylethanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127021991 |
| Molecular Formula | C23H29F6N3O7 |
| Molecular Weight | 573.49 g/mol |
| Exact Mass | 573.19 |
| IUPAC Name | 2-[(3aR,7S,7aS)-2-(pyridin-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-1-morpholin-4-ylethanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(C[C@@H]1COC[C@H]2CN(Cc3ccccn3)C[C@@H]12)N1CCOCC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H27N3O3.2C2HF3O2/c23-19(22-5-7-24-8-6-22)9-15-13-25-14-16-10-21(12-18(15)16)11-17-3-1-2-4-20-17;2*3-2(4,5)1(6)7/h1-4,15-16,18H,5-14H2;2*(H,6,7)/t15-,16-,18+;;/m1../s1 |
| InChIKey | XCPCSOBDBWGGEV-JQVFSJMQSA-N |
| XLogP | 2.29 |
| TPSA | 129.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.49 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |