C19H25F9N4O7 — CID 127022349
(3S,3aR,6aS)-N,N-dimethyl-1-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-amine;tris(2,2,2-trifluoroacetic acid) (PubChem CID 127022349) has the molecular formula C19H25F9N4O7 and a molecular weight of 592.41 g/mol. Its IUPAC name is (3S,3aR,6aS)-N,N-dimethyl-1-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-amine;tris(2,2,2-trifluoroacetic acid).
| Compound Name | (3S,3aR,6aS)-N,N-dimethyl-1-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-amine;tris(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127022349 |
| Molecular Formula | C19H25F9N4O7 |
| Molecular Weight | 592.41 g/mol |
| Exact Mass | 592.16 |
| IUPAC Name | (3S,3aR,6aS)-N,N-dimethyl-1-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-amine;tris(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)[C@@H]1CN(Cc2cnn(C)c2)[C@@H]2COC[C@H]12.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H22N4O.3C2HF3O2/c1-15(2)12-7-17(13-9-18-8-11(12)13)6-10-4-14-16(3)5-10;3*3-2(4,5)1(6)7/h4-5,11-13H,6-9H2,1-3H3;3*(H,6,7)/t11-,12-,13-;;;/m1.../s1 |
| InChIKey | AXUDREFIALEKMG-QQAVRSNOSA-N |
| XLogP | 2.08 |
| TPSA | 145.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |