C19H31F3N4O5 — CID 127022366
(1R,5S,6S)-3-N-cyclopentyl-6-N-[2-(dimethylamino)ethyl]-8-oxa-3-azabicyclo[3.2.1]octane-3,6-dicarboxamide;2,2,2-trifluoroacetic acid (PubChem CID 127022366) has the molecular formula C19H31F3N4O5 and a molecular weight of 452.47 g/mol. Its IUPAC name is (1R,5S,6S)-3-N-cyclopentyl-6-N-[2-(dimethylamino)ethyl]-8-oxa-3-azabicyclo[3.2.1]octane-3,6-dicarboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (1R,5S,6S)-3-N-cyclopentyl-6-N-[2-(dimethylamino)ethyl]-8-oxa-3-azabicyclo[3.2.1]octane-3,6-dicarboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127022366 |
| Molecular Formula | C19H31F3N4O5 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | (1R,5S,6S)-3-N-cyclopentyl-6-N-[2-(dimethylamino)ethyl]-8-oxa-3-azabicyclo[3.2.1]octane-3,6-dicarboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)CCNC(=O)[C@H]1C[C@@H]2CN(C(=O)NC3CCCC3)C[C@H]1O2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H30N4O3.C2HF3O2/c1-20(2)8-7-18-16(22)14-9-13-10-21(11-15(14)24-13)17(23)19-12-5-3-4-6-12;3-2(4,5)1(6)7/h12-15H,3-11H2,1-2H3,(H,18,22)(H,19,23);(H,6,7)/t13-,14+,15-;/m1./s1 |
| InChIKey | NHVIBDYDGWXKPV-USAYTKQKSA-N |
| XLogP | 1.04 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |