C18H32N4O4S — CID 125238521
(4R,4aR,7aR)-6-N-cyclopentyl-4-N-[2-(dimethylamino)ethyl]-1,1-dioxo-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4,6-dicarboxamide (PubChem CID 125238521) has the molecular formula C18H32N4O4S and a molecular weight of 400.55 g/mol. Its IUPAC name is (4R,4aR,7aR)-6-N-cyclopentyl-4-N-[2-(dimethylamino)ethyl]-1,1-dioxo-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4,6-dicarboxamide.
| Compound Name | (4R,4aR,7aR)-6-N-cyclopentyl-4-N-[2-(dimethylamino)ethyl]-1,1-dioxo-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4,6-dicarboxamide |
|---|---|
| PubChem CID | 125238521 |
| Molecular Formula | C18H32N4O4S |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | (4R,4aR,7aR)-6-N-cyclopentyl-4-N-[2-(dimethylamino)ethyl]-1,1-dioxo-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4,6-dicarboxamide |
| SMILES | CN(C)CCNC(=O)[C@@H]1CCS(=O)(=O)[C@H]2CN(C(=O)NC3CCCC3)C[C@@H]12 |
| InChI | InChI=1S/C18H32N4O4S/c1-21(2)9-8-19-17(23)14-7-10-27(25,26)16-12-22(11-15(14)16)18(24)20-13-5-3-4-6-13/h13-16H,3-12H2,1-2H3,(H,19,23)(H,20,24)/t14-,15+,16+/m1/s1 |
| InChIKey | LJAMXOVHAKYIKT-PMPSAXMXSA-N |
| XLogP | 0.05 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |