C19H32F3N3O5S — CID 127022739
(3aS,6aS)-1'-ethylsulfonyl-N,N,2-trimethylspiro[3,4,5,6a-tetrahydro-1H-cyclopenta[c]pyrrole-6,4'-piperidine]-3a-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 127022739) has the molecular formula C19H32F3N3O5S and a molecular weight of 471.54 g/mol. Its IUPAC name is (3aS,6aS)-1'-ethylsulfonyl-N,N,2-trimethylspiro[3,4,5,6a-tetrahydro-1H-cyclopenta[c]pyrrole-6,4'-piperidine]-3a-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aS,6aS)-1'-ethylsulfonyl-N,N,2-trimethylspiro[3,4,5,6a-tetrahydro-1H-cyclopenta[c]pyrrole-6,4'-piperidine]-3a-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127022739 |
| Molecular Formula | C19H32F3N3O5S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | (3aS,6aS)-1'-ethylsulfonyl-N,N,2-trimethylspiro[3,4,5,6a-tetrahydro-1H-cyclopenta[c]pyrrole-6,4'-piperidine]-3a-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCS(=O)(=O)N1CCC2(CC1)CC[C@@]1(C(=O)N(C)C)CN(C)C[C@@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H31N3O3S.C2HF3O2/c1-5-24(22,23)20-10-8-16(9-11-20)6-7-17(15(21)18(2)3)13-19(4)12-14(16)17;3-2(4,5)1(6)7/h14H,5-13H2,1-4H3;(H,6,7)/t14-,17+;/m0./s1 |
| InChIKey | JTSCVNTWGCWPDE-SQQLFYIASA-N |
| XLogP | 1.48 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |