C22H33N3O3S — CID 97439449
(3aS,6aS)-1'-(benzenesulfonyl)-2-ethyl-N,N-dimethylspiro[3,4,5,6a-tetrahydro-1H-cyclopenta[c]pyrrole-6,4'-piperidine]-3a-carboxamide (PubChem CID 97439449) has the molecular formula C22H33N3O3S and a molecular weight of 419.59 g/mol. Its IUPAC name is (3aS,6aS)-1'-(benzenesulfonyl)-2-ethyl-N,N-dimethylspiro[3,4,5,6a-tetrahydro-1H-cyclopenta[c]pyrrole-6,4'-piperidine]-3a-carboxamide.
| Compound Name | (3aS,6aS)-1'-(benzenesulfonyl)-2-ethyl-N,N-dimethylspiro[3,4,5,6a-tetrahydro-1H-cyclopenta[c]pyrrole-6,4'-piperidine]-3a-carboxamide |
|---|---|
| PubChem CID | 97439449 |
| Molecular Formula | C22H33N3O3S |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | (3aS,6aS)-1'-(benzenesulfonyl)-2-ethyl-N,N-dimethylspiro[3,4,5,6a-tetrahydro-1H-cyclopenta[c]pyrrole-6,4'-piperidine]-3a-carboxamide |
| SMILES | CCN1C[C@H]2C3(CCN(S(=O)(=O)c4ccccc4)CC3)CC[C@@]2(C(=O)N(C)C)C1 |
| InChI | InChI=1S/C22H33N3O3S/c1-4-24-16-19-21(10-11-22(19,17-24)20(26)23(2)3)12-14-25(15-13-21)29(27,28)18-8-6-5-7-9-18/h5-9,19H,4,10-17H2,1-3H3/t19-,22+/m0/s1 |
| InChIKey | RLWJKMLPVVLZPU-SIKLNZKXSA-N |
| XLogP | 2.28 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |