C15H24N2O3S — CID 137334939
[1-(benzenesulfonyl)-4-[(dimethylamino)methyl]piperidin-4-yl]methanol (PubChem CID 137334939) has the molecular formula C15H24N2O3S and a molecular weight of 312.43 g/mol. Its IUPAC name is [1-(benzenesulfonyl)-4-[(dimethylamino)methyl]piperidin-4-yl]methanol.
| Compound Name | [1-(benzenesulfonyl)-4-[(dimethylamino)methyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 137334939 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | [1-(benzenesulfonyl)-4-[(dimethylamino)methyl]piperidin-4-yl]methanol |
| SMILES | CN(C)CC1(CO)CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C15H24N2O3S/c1-16(2)12-15(13-18)8-10-17(11-9-15)21(19,20)14-6-4-3-5-7-14/h3-7,18H,8-13H2,1-2H3 |
| InChIKey | MNVWLSMFSUSDPT-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |