C16H23N3O3S — CID 137340198
2-[4-[(dimethylamino)methyl]-4-(hydroxymethyl)piperidin-1-yl]sulfonylbenzonitrile (PubChem CID 137340198) has the molecular formula C16H23N3O3S and a molecular weight of 337.44 g/mol. Its IUPAC name is 2-[4-[(dimethylamino)methyl]-4-(hydroxymethyl)piperidin-1-yl]sulfonylbenzonitrile.
| Compound Name | 2-[4-[(dimethylamino)methyl]-4-(hydroxymethyl)piperidin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 137340198 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 2-[4-[(dimethylamino)methyl]-4-(hydroxymethyl)piperidin-1-yl]sulfonylbenzonitrile |
| SMILES | CN(C)CC1(CO)CCN(S(=O)(=O)c2ccccc2C#N)CC1 |
| InChI | InChI=1S/C16H23N3O3S/c1-18(2)12-16(13-20)7-9-19(10-8-16)23(21,22)15-6-4-3-5-14(15)11-17/h3-6,20H,7-10,12-13H2,1-2H3 |
| InChIKey | ZQLGAPGBDQXCNH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |