C17H28N2O4S — CID 137339136
[4-[(dimethylamino)methyl]-1-(4-ethoxyphenyl)sulfonylpiperidin-4-yl]methanol (PubChem CID 137339136) has the molecular formula C17H28N2O4S and a molecular weight of 356.49 g/mol. Its IUPAC name is [4-[(dimethylamino)methyl]-1-(4-ethoxyphenyl)sulfonylpiperidin-4-yl]methanol.
| Compound Name | [4-[(dimethylamino)methyl]-1-(4-ethoxyphenyl)sulfonylpiperidin-4-yl]methanol |
|---|---|
| PubChem CID | 137339136 |
| Molecular Formula | C17H28N2O4S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | [4-[(dimethylamino)methyl]-1-(4-ethoxyphenyl)sulfonylpiperidin-4-yl]methanol |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCC(CO)(CN(C)C)CC2)cc1 |
| InChI | InChI=1S/C17H28N2O4S/c1-4-23-15-5-7-16(8-6-15)24(21,22)19-11-9-17(14-20,10-12-19)13-18(2)3/h5-8,20H,4,9-14H2,1-3H3 |
| InChIKey | UPLLPLFAOVXJCO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |