C22H23F6N5O6 — CID 127022875
[(7R,8aS)-7-(pyridin-3-ylmethoxy)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-pyridazin-4-ylmethanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127022875) has the molecular formula C22H23F6N5O6 and a molecular weight of 567.44 g/mol. Its IUPAC name is [(7R,8aS)-7-(pyridin-3-ylmethoxy)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-pyridazin-4-ylmethanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | [(7R,8aS)-7-(pyridin-3-ylmethoxy)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-pyridazin-4-ylmethanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127022875 |
| Molecular Formula | C22H23F6N5O6 |
| Molecular Weight | 567.44 g/mol |
| Exact Mass | 567.16 |
| IUPAC Name | [(7R,8aS)-7-(pyridin-3-ylmethoxy)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-pyridazin-4-ylmethanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=C(c1ccnnc1)N1CCN2C[C@H](OCc3cccnc3)C[C@H]2C1 |
| InChI | InChI=1S/C18H21N5O2.2C2HF3O2/c24-18(15-3-5-20-21-10-15)23-7-6-22-12-17(8-16(22)11-23)25-13-14-2-1-4-19-9-14;2*3-2(4,5)1(6)7/h1-5,9-10,16-17H,6-8,11-13H2;2*(H,6,7)/t16-,17+;;/m0../s1 |
| InChIKey | BJDKMVMSUCSBPL-UXHRTOHASA-N |
| XLogP | 2.25 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |