C21H22F4N2O5 — CID 155826847
[(7R,8aS)-7-[(2-fluorophenyl)methoxy]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(furan-2-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155826847) has the molecular formula C21H22F4N2O5 and a molecular weight of 458.41 g/mol. Its IUPAC name is [(7R,8aS)-7-[(2-fluorophenyl)methoxy]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(furan-2-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(7R,8aS)-7-[(2-fluorophenyl)methoxy]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(furan-2-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155826847 |
| Molecular Formula | C21H22F4N2O5 |
| Molecular Weight | 458.41 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | [(7R,8aS)-7-[(2-fluorophenyl)methoxy]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(furan-2-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1ccco1)N1CCN2C[C@H](OCc3ccccc3F)C[C@H]2C1 |
| InChI | InChI=1S/C19H21FN2O3.C2HF3O2/c20-17-5-2-1-4-14(17)13-25-16-10-15-11-22(8-7-21(15)12-16)19(23)18-6-3-9-24-18;3-2(4,5)1(6)7/h1-6,9,15-16H,7-8,10-13H2;(H,6,7)/t15-,16+;/m0./s1 |
| InChIKey | XIBIUHSLEUTHTF-IDVLALEDSA-N |
| XLogP | 3.17 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |