C19H20F6N4O5S — CID 127023031
(4aR,7aS)-4-pyrimidin-2-yl-6-(thiophen-3-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127023031) has the molecular formula C19H20F6N4O5S and a molecular weight of 530.45 g/mol. Its IUPAC name is (4aR,7aS)-4-pyrimidin-2-yl-6-(thiophen-3-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (4aR,7aS)-4-pyrimidin-2-yl-6-(thiophen-3-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127023031 |
| Molecular Formula | C19H20F6N4O5S |
| Molecular Weight | 530.45 g/mol |
| Exact Mass | 530.11 |
| IUPAC Name | (4aR,7aS)-4-pyrimidin-2-yl-6-(thiophen-3-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1cnc(N2CCO[C@H]3CN(Cc4ccsc4)C[C@H]32)nc1 |
| InChI | InChI=1S/C15H18N4OS.2C2HF3O2/c1-3-16-15(17-4-1)19-5-6-20-14-10-18(9-13(14)19)8-12-2-7-21-11-12;2*3-2(4,5)1(6)7/h1-4,7,11,13-14H,5-6,8-10H2;2*(H,6,7)/t13-,14+;;/m1../s1 |
| InChIKey | IQSUXWCZBWOOFA-BQFBZIMZSA-N |
| XLogP | 2.89 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |