C19H25F4N5O4 — CID 127023127
[(2R,3aS,7aR)-6-(5-fluoropyrimidin-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-(4-methylpiperazin-1-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 127023127) has the molecular formula C19H25F4N5O4 and a molecular weight of 463.43 g/mol. Its IUPAC name is [(2R,3aS,7aR)-6-(5-fluoropyrimidin-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-(4-methylpiperazin-1-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(2R,3aS,7aR)-6-(5-fluoropyrimidin-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-(4-methylpiperazin-1-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127023127 |
| Molecular Formula | C19H25F4N5O4 |
| Molecular Weight | 463.43 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | [(2R,3aS,7aR)-6-(5-fluoropyrimidin-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-(4-methylpiperazin-1-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | CN1CCN(C(=O)[C@H]2C[C@@H]3CCN(c4ncc(F)cn4)C[C@@H]3O2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24FN5O2.C2HF3O2/c1-21-4-6-22(7-5-21)16(24)14-8-12-2-3-23(11-15(12)25-14)17-19-9-13(18)10-20-17;3-2(4,5)1(6)7/h9-10,12,14-15H,2-8,11H2,1H3;(H,6,7)/t12-,14+,15-;/m0./s1 |
| InChIKey | NRETWMCWPGLJKA-DWGNNRDYSA-N |
| XLogP | 1.01 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.43 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |