C18H24F4N4O3 — CID 127023683
(4aR,7aS)-6-(cyclopentylmethyl)-4-(5-fluoropyrimidin-2-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine;2,2,2-trifluoroacetic acid (PubChem CID 127023683) has the molecular formula C18H24F4N4O3 and a molecular weight of 420.41 g/mol. Its IUPAC name is (4aR,7aS)-6-(cyclopentylmethyl)-4-(5-fluoropyrimidin-2-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine;2,2,2-trifluoroacetic acid.
| Compound Name | (4aR,7aS)-6-(cyclopentylmethyl)-4-(5-fluoropyrimidin-2-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127023683 |
| Molecular Formula | C18H24F4N4O3 |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | (4aR,7aS)-6-(cyclopentylmethyl)-4-(5-fluoropyrimidin-2-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine;2,2,2-trifluoroacetic acid |
| SMILES | Fc1cnc(N2CCO[C@H]3CN(CC4CCCC4)C[C@H]32)nc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H23FN4O.C2HF3O2/c17-13-7-18-16(19-8-13)21-5-6-22-15-11-20(10-14(15)21)9-12-3-1-2-4-12;3-2(4,5)1(6)7/h7-8,12,14-15H,1-6,9-11H2;(H,6,7)/t14-,15+;/m1./s1 |
| InChIKey | RYVWKQFJOZSCLF-LIOBNPLQSA-N |
| XLogP | 2.33 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |