C30H43N3O5 — CID 127024803
formic acid;(1R,2R,3R,4S)-3-N-[(4-propan-2-yloxyphenyl)methyl]-2-N-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide (PubChem CID 127024803) has the molecular formula C30H43N3O5 and a molecular weight of 525.69 g/mol. Its IUPAC name is formic acid;(1R,2R,3R,4S)-3-N-[(4-propan-2-yloxyphenyl)methyl]-2-N-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide.
| Compound Name | formic acid;(1R,2R,3R,4S)-3-N-[(4-propan-2-yloxyphenyl)methyl]-2-N-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
|---|---|
| PubChem CID | 127024803 |
| Molecular Formula | C30H43N3O5 |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.32 |
| IUPAC Name | formic acid;(1R,2R,3R,4S)-3-N-[(4-propan-2-yloxyphenyl)methyl]-2-N-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
| SMILES | CC(C)Oc1ccc(CNC(=O)[C@H]2[C@H](C(=O)NCCCCN3CCCC3)[C@H]3C=C[C@@H]2C32CC2)cc1.O=CO |
| InChI | InChI=1S/C29H41N3O3.CH2O2/c1-20(2)35-22-9-7-21(8-10-22)19-31-28(34)26-24-12-11-23(29(24)13-14-29)25(26)27(33)30-15-3-4-16-32-17-5-6-18-32;2-1-3/h7-12,20,23-26H,3-6,13-19H2,1-2H3,(H,30,33)(H,31,34);1H,(H,2,3)/t23-,24+,25-,26-;/m1./s1 |
| InChIKey | UDUSCRZMZVWBAG-QJRGHEQESA-N |
| XLogP | 3.61 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|