C25H35ClN4O3 — CID 127035919
(1R,2R,3R,4S)-3-N-(6-methoxy-3-pyridinyl)-2-N-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide;hydrochloride (PubChem CID 127035919) has the molecular formula C25H35ClN4O3 and a molecular weight of 475.03 g/mol. Its IUPAC name is (1R,2R,3R,4S)-3-N-(6-methoxy-3-pyridinyl)-2-N-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide;hydrochloride.
| Compound Name | (1R,2R,3R,4S)-3-N-(6-methoxy-3-pyridinyl)-2-N-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide;hydrochloride |
|---|---|
| PubChem CID | 127035919 |
| Molecular Formula | C25H35ClN4O3 |
| Molecular Weight | 475.03 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | (1R,2R,3R,4S)-3-N-(6-methoxy-3-pyridinyl)-2-N-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide;hydrochloride |
| SMILES | COc1ccc(NC(=O)[C@H]2[C@H](C(=O)NCCCCN3CCCC3)[C@H]3C=C[C@@H]2C32CC2)cn1.Cl |
| InChI | InChI=1S/C25H34N4O3.ClH/c1-32-20-9-6-17(16-27-20)28-24(31)22-19-8-7-18(25(19)10-11-25)21(22)23(30)26-12-2-3-13-29-14-4-5-15-29;/h6-9,16,18-19,21-22H,2-5,10-15H2,1H3,(H,26,30)(H,28,31);1H/t18-,19+,21-,22-;/m1./s1 |
| InChIKey | XZEIGLSLNVSJQC-FKFVOXPGSA-N |
| XLogP | 3.27 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.03 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|