C28H33ClN4O2S — CID 87421997
(1R,2R,3R,4S)-3-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-N-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide (PubChem CID 87421997) has the molecular formula C28H33ClN4O2S and a molecular weight of 525.12 g/mol. Its IUPAC name is (1R,2R,3R,4S)-3-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-N-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide.
| Compound Name | (1R,2R,3R,4S)-3-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-N-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
|---|---|
| PubChem CID | 87421997 |
| Molecular Formula | C28H33ClN4O2S |
| Molecular Weight | 525.12 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | (1R,2R,3R,4S)-3-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-N-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
| SMILES | O=C(NCCCCN1CCCC1)[C@H]1[C@H](C(=O)Nc2nc(-c3ccc(Cl)cc3)cs2)[C@@H]2C=C[C@H]1C21CC1 |
| InChI | InChI=1S/C28H33ClN4O2S/c29-19-7-5-18(6-8-19)22-17-36-27(31-22)32-26(35)24-21-10-9-20(28(21)11-12-28)23(24)25(34)30-13-1-2-14-33-15-3-4-16-33/h5-10,17,20-21,23-24H,1-4,11-16H2,(H,30,34)(H,31,32,35)/t20-,21+,23-,24-/m1/s1 |
| InChIKey | BTXHVXZYPFMNGF-CBJLPSGESA-N |
| XLogP | 5.22 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.12 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|