C11H12BrN — CID 127024854
6-(3-bromophenyl)-2,3,4,5-tetrahydropyridine (PubChem CID 127024854) has the molecular formula C11H12BrN and a molecular weight of 238.13 g/mol. Its IUPAC name is 6-(3-bromophenyl)-2,3,4,5-tetrahydropyridine.
| Compound Name | 6-(3-bromophenyl)-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 127024854 |
| Molecular Formula | C11H12BrN |
| Molecular Weight | 238.13 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 6-(3-bromophenyl)-2,3,4,5-tetrahydropyridine |
| SMILES | Brc1cccc(C2=NCCCC2)c1 |
| InChI | InChI=1S/C11H12BrN/c12-10-5-3-4-9(8-10)11-6-1-2-7-13-11/h3-5,8H,1-2,6-7H2 |
| InChIKey | IAPFRWYGZQXILQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.13 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |