C29H35N3O2 — CID 127024905
4-[[4-[2-(4-methylphenyl)-5-(piperidin-4-ylmethoxy)-3-pyridinyl]phenyl]methyl]morpholine (PubChem CID 127024905) has the molecular formula C29H35N3O2 and a molecular weight of 457.62 g/mol. Its IUPAC name is 4-[[4-[2-(4-methylphenyl)-5-(piperidin-4-ylmethoxy)-3-pyridinyl]phenyl]methyl]morpholine.
| Compound Name | 4-[[4-[2-(4-methylphenyl)-5-(piperidin-4-ylmethoxy)-3-pyridinyl]phenyl]methyl]morpholine |
|---|---|
| PubChem CID | 127024905 |
| Molecular Formula | C29H35N3O2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | 4-[[4-[2-(4-methylphenyl)-5-(piperidin-4-ylmethoxy)-3-pyridinyl]phenyl]methyl]morpholine |
| SMILES | Cc1ccc(-c2ncc(OCC3CCNCC3)cc2-c2ccc(CN3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C29H35N3O2/c1-22-2-6-26(7-3-22)29-28(18-27(19-31-29)34-21-24-10-12-30-13-11-24)25-8-4-23(5-9-25)20-32-14-16-33-17-15-32/h2-9,18-19,24,30H,10-17,20-21H2,1H3 |
| InChIKey | JUQVMTDJTHTBTD-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |