C25H28N2O2 — CID 127026390
[4-[2-(4-methylphenyl)-5-(piperidin-4-ylmethoxy)-3-pyridinyl]phenyl]methanol (PubChem CID 127026390) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is [4-[2-(4-methylphenyl)-5-(piperidin-4-ylmethoxy)-3-pyridinyl]phenyl]methanol.
| Compound Name | [4-[2-(4-methylphenyl)-5-(piperidin-4-ylmethoxy)-3-pyridinyl]phenyl]methanol |
|---|---|
| PubChem CID | 127026390 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | [4-[2-(4-methylphenyl)-5-(piperidin-4-ylmethoxy)-3-pyridinyl]phenyl]methanol |
| SMILES | Cc1ccc(-c2ncc(OCC3CCNCC3)cc2-c2ccc(CO)cc2)cc1 |
| InChI | InChI=1S/C25H28N2O2/c1-18-2-6-22(7-3-18)25-24(21-8-4-19(16-28)5-9-21)14-23(15-27-25)29-17-20-10-12-26-13-11-20/h2-9,14-15,20,26,28H,10-13,16-17H2,1H3 |
| InChIKey | XMDKHHYDZUATHI-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |