C17H24O3 — CID 127025136
ethyl (2R)-2-[(2S,8S,8aR)-8,8a-dimethyl-3-oxo-1,2,7,8-tetrahydronaphthalen-2-yl]propanoate (PubChem CID 127025136) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is ethyl (2R)-2-[(2S,8S,8aR)-8,8a-dimethyl-3-oxo-1,2,7,8-tetrahydronaphthalen-2-yl]propanoate.
| Compound Name | ethyl (2R)-2-[(2S,8S,8aR)-8,8a-dimethyl-3-oxo-1,2,7,8-tetrahydronaphthalen-2-yl]propanoate |
|---|---|
| PubChem CID | 127025136 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | ethyl (2R)-2-[(2S,8S,8aR)-8,8a-dimethyl-3-oxo-1,2,7,8-tetrahydronaphthalen-2-yl]propanoate |
| SMILES | CCOC(=O)[C@H](C)[C@@H]1C[C@@]2(C)C(=CC1=O)C=CC[C@@H]2C |
| InChI | InChI=1S/C17H24O3/c1-5-20-16(19)12(3)14-10-17(4)11(2)7-6-8-13(17)9-15(14)18/h6,8-9,11-12,14H,5,7,10H2,1-4H3/t11-,12+,14-,17+/m0/s1 |
| InChIKey | OHJUJCOYKITUHW-GMIGKAJZSA-N |
| XLogP | 3.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |