C19H13NO4S — CID 127025716
2-hydroxy-4-[5-(1-oxo-3H-2-benzofuran-5-yl)thiophen-2-yl]benzamide (PubChem CID 127025716) has the molecular formula C19H13NO4S and a molecular weight of 351.38 g/mol. Its IUPAC name is 2-hydroxy-4-[5-(1-oxo-3H-2-benzofuran-5-yl)thiophen-2-yl]benzamide.
| Compound Name | 2-hydroxy-4-[5-(1-oxo-3H-2-benzofuran-5-yl)thiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 127025716 |
| Molecular Formula | C19H13NO4S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 2-hydroxy-4-[5-(1-oxo-3H-2-benzofuran-5-yl)thiophen-2-yl]benzamide |
| SMILES | NC(=O)c1ccc(-c2ccc(-c3ccc4c(c3)COC4=O)s2)cc1O |
| InChI | InChI=1S/C19H13NO4S/c20-18(22)14-4-2-11(8-15(14)21)17-6-5-16(25-17)10-1-3-13-12(7-10)9-24-19(13)23/h1-8,21H,9H2,(H2,20,22) |
| InChIKey | CZBUHFFVQRWPLQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |