C15H13Cl2N3O2 — CID 127026210
4-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methylamino]phenol;hydrochloride (PubChem CID 127026210) has the molecular formula C15H13Cl2N3O2 and a molecular weight of 338.19 g/mol. Its IUPAC name is 4-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methylamino]phenol;hydrochloride.
| Compound Name | 4-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methylamino]phenol;hydrochloride |
|---|---|
| PubChem CID | 127026210 |
| Molecular Formula | C15H13Cl2N3O2 |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 4-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methylamino]phenol;hydrochloride |
| SMILES | Cl.Oc1ccc(NCc2nnc(-c3ccc(Cl)cc3)o2)cc1 |
| InChI | InChI=1S/C15H12ClN3O2.ClH/c16-11-3-1-10(2-4-11)15-19-18-14(21-15)9-17-12-5-7-13(20)8-6-12;/h1-8,17,20H,9H2;1H |
| InChIKey | GVKVKSBTRRHOMR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|