C17H17N3O2 — CID 155810761
4-[5-[(2,6-dimethylanilino)methyl]-1,3,4-oxadiazol-2-yl]phenol (PubChem CID 155810761) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 4-[5-[(2,6-dimethylanilino)methyl]-1,3,4-oxadiazol-2-yl]phenol.
| Compound Name | 4-[5-[(2,6-dimethylanilino)methyl]-1,3,4-oxadiazol-2-yl]phenol |
|---|---|
| PubChem CID | 155810761 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 4-[5-[(2,6-dimethylanilino)methyl]-1,3,4-oxadiazol-2-yl]phenol |
| SMILES | Cc1cccc(C)c1NCc1nnc(-c2ccc(O)cc2)o1 |
| InChI | InChI=1S/C17H17N3O2/c1-11-4-3-5-12(2)16(11)18-10-15-19-20-17(22-15)13-6-8-14(21)9-7-13/h3-9,18,21H,10H2,1-2H3 |
| InChIKey | MKCUYHVGPGEKMN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |