C15H13BrN2OS — CID 127026459
(7E)-7-[(4-bromophenyl)methylidene]-3-methyl-5,6-dihydro-[1,3]thiazolo[3,2-a][1,3]diazepin-8-one (PubChem CID 127026459) has the molecular formula C15H13BrN2OS and a molecular weight of 349.25 g/mol. Its IUPAC name is (7E)-7-[(4-bromophenyl)methylidene]-3-methyl-5,6-dihydro-[1,3]thiazolo[3,2-a][1,3]diazepin-8-one.
| Compound Name | (7E)-7-[(4-bromophenyl)methylidene]-3-methyl-5,6-dihydro-[1,3]thiazolo[3,2-a][1,3]diazepin-8-one |
|---|---|
| PubChem CID | 127026459 |
| Molecular Formula | C15H13BrN2OS |
| Molecular Weight | 349.25 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | (7E)-7-[(4-bromophenyl)methylidene]-3-methyl-5,6-dihydro-[1,3]thiazolo[3,2-a][1,3]diazepin-8-one |
| SMILES | CC1=CSC2=NC(=O)/C(=C/c3ccc(Br)cc3)CCN12 |
| InChI | InChI=1S/C15H13BrN2OS/c1-10-9-20-15-17-14(19)12(6-7-18(10)15)8-11-2-4-13(16)5-3-11/h2-5,8-9H,6-7H2,1H3/b12-8+ |
| InChIKey | YVCDNYRQYHIVLE-XYOKQWHBSA-N |
| XLogP | 4.03 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.25 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|