C18H17N3O3 — CID 127026636
3-amino-2-(3,4-dihydroxyphenyl)-N-isoquinolin-6-ylpropanamide (PubChem CID 127026636) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 3-amino-2-(3,4-dihydroxyphenyl)-N-isoquinolin-6-ylpropanamide.
| Compound Name | 3-amino-2-(3,4-dihydroxyphenyl)-N-isoquinolin-6-ylpropanamide |
|---|---|
| PubChem CID | 127026636 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 3-amino-2-(3,4-dihydroxyphenyl)-N-isoquinolin-6-ylpropanamide |
| SMILES | NCC(C(=O)Nc1ccc2cnccc2c1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C18H17N3O3/c19-9-15(12-2-4-16(22)17(23)8-12)18(24)21-14-3-1-13-10-20-6-5-11(13)7-14/h1-8,10,15,22-23H,9,19H2,(H,21,24) |
| InChIKey | VWNKWTPRMLMOGX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|