C8H6N2O3S — CID 127027462
N-hydroxy-2-thiophen-2-yl-1,3-oxazole-4-carboxamide (PubChem CID 127027462) has the molecular formula C8H6N2O3S and a molecular weight of 210.21 g/mol. Its IUPAC name is N-hydroxy-2-thiophen-2-yl-1,3-oxazole-4-carboxamide.
| Compound Name | N-hydroxy-2-thiophen-2-yl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 127027462 |
| Molecular Formula | C8H6N2O3S |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | N-hydroxy-2-thiophen-2-yl-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NO)c1coc(-c2cccs2)n1 |
| InChI | InChI=1S/C8H6N2O3S/c11-7(10-12)5-4-13-8(9-5)6-2-1-3-14-6/h1-4,12H,(H,10,11) |
| InChIKey | HJQZGXABNBZCDG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|