C13H10ClN5O3 — CID 127027555
1-[4-amino-3-(4-chlorophenyl)-1H-pyrazole-5-carbonyl]pyrazolidine-3,5-dione (PubChem CID 127027555) has the molecular formula C13H10ClN5O3 and a molecular weight of 319.71 g/mol. Its IUPAC name is 1-[4-amino-3-(4-chlorophenyl)-1H-pyrazole-5-carbonyl]pyrazolidine-3,5-dione.
| Compound Name | 1-[4-amino-3-(4-chlorophenyl)-1H-pyrazole-5-carbonyl]pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 127027555 |
| Molecular Formula | C13H10ClN5O3 |
| Molecular Weight | 319.71 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 1-[4-amino-3-(4-chlorophenyl)-1H-pyrazole-5-carbonyl]pyrazolidine-3,5-dione |
| SMILES | Nc1c(-c2ccc(Cl)cc2)n[nH]c1C(=O)N1NC(=O)CC1=O |
| InChI | InChI=1S/C13H10ClN5O3/c14-7-3-1-6(2-4-7)11-10(15)12(17-16-11)13(22)19-9(21)5-8(20)18-19/h1-4H,5,15H2,(H,16,17)(H,18,20) |
| InChIKey | YGHOVWZDTORZAC-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.71 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|