C11H11ClN6OS — CID 127026644
[[4-amino-3-(4-chlorophenyl)-1H-pyrazole-5-carbonyl]amino]thiourea (PubChem CID 127026644) has the molecular formula C11H11ClN6OS and a molecular weight of 310.77 g/mol. Its IUPAC name is [[4-amino-3-(4-chlorophenyl)-1H-pyrazole-5-carbonyl]amino]thiourea.
| Compound Name | [[4-amino-3-(4-chlorophenyl)-1H-pyrazole-5-carbonyl]amino]thiourea |
|---|---|
| PubChem CID | 127026644 |
| Molecular Formula | C11H11ClN6OS |
| Molecular Weight | 310.77 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | [[4-amino-3-(4-chlorophenyl)-1H-pyrazole-5-carbonyl]amino]thiourea |
| SMILES | NC(=S)NNC(=O)c1[nH]nc(-c2ccc(Cl)cc2)c1N |
| InChI | InChI=1S/C11H11ClN6OS/c12-6-3-1-5(2-4-6)8-7(13)9(16-15-8)10(19)17-18-11(14)20/h1-4H,13H2,(H,15,16)(H,17,19)(H3,14,18,20) |
| InChIKey | WXQWYOQAJCTPDJ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 121.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.77 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|